C18H11F6NO3 — CID 169082608
methyl 5-(trifluoromethyl)-2-[5-(3,4,5-trifluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]benzoate (PubChem CID 169082608) has the molecular formula C18H11F6NO3 and a molecular weight of 403.28 g/mol. Its IUPAC name is methyl 5-(trifluoromethyl)-2-[5-(3,4,5-trifluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]benzoate.
| Compound Name | methyl 5-(trifluoromethyl)-2-[5-(3,4,5-trifluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 169082608 |
| Molecular Formula | C18H11F6NO3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | methyl 5-(trifluoromethyl)-2-[5-(3,4,5-trifluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]benzoate |
| SMILES | COC(=O)c1cc(C(F)(F)F)ccc1C1=NOC(c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C18H11F6NO3/c1-27-17(26)11-6-9(18(22,23)24)2-3-10(11)14-7-15(28-25-14)8-4-12(19)16(21)13(20)5-8/h2-6,15H,7H2,1H3 |
| InChIKey | WSQQKVJKRLIGRT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|