C11H4F10 — CID 169082676
1,1,2,2,3,3,4,4,5,8-decafluoro-6-methylnaphthalene (PubChem CID 169082676) has the molecular formula C11H4F10 and a molecular weight of 326.13 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,8-decafluoro-6-methylnaphthalene.
| Compound Name | 1,1,2,2,3,3,4,4,5,8-decafluoro-6-methylnaphthalene |
|---|---|
| PubChem CID | 169082676 |
| Molecular Formula | C11H4F10 |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,8-decafluoro-6-methylnaphthalene |
| SMILES | Cc1cc(F)c2c(c1F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C11H4F10/c1-3-2-4(12)5-6(7(3)13)9(16,17)11(20,21)10(18,19)8(5,14)15/h2H,1H3 |
| InChIKey | MXMZMVYGOGQPLD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|