C23H28N4O — CID 169082845
6-[benzyl(butyl)amino]-2-pyridin-2-yl-4,5,6,7-tetrahydro-1H-indazol-3-one (PubChem CID 169082845) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 6-[benzyl(butyl)amino]-2-pyridin-2-yl-4,5,6,7-tetrahydro-1H-indazol-3-one.
| Compound Name | 6-[benzyl(butyl)amino]-2-pyridin-2-yl-4,5,6,7-tetrahydro-1H-indazol-3-one |
|---|---|
| PubChem CID | 169082845 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 6-[benzyl(butyl)amino]-2-pyridin-2-yl-4,5,6,7-tetrahydro-1H-indazol-3-one |
| SMILES | CCCCN(Cc1ccccc1)C1CCc2c([nH]n(-c3ccccn3)c2=O)C1 |
| InChI | InChI=1S/C23H28N4O/c1-2-3-15-26(17-18-9-5-4-6-10-18)19-12-13-20-21(16-19)25-27(23(20)28)22-11-7-8-14-24-22/h4-11,14,19,25H,2-3,12-13,15-17H2,1H3 |
| InChIKey | FTNZNBMVGJZGTG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |