About CID 169083425
CID 169083425 (PubChem CID 169083425) has the molecular formula C20H41O2Si
and a molecular weight of 341.63 g/mol.
Molecular Properties
| Compound Name | CID 169083425 |
| PubChem CID | 169083425 |
| Molecular Formula | C20H41O2Si |
| Molecular Weight | 341.63 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | — |
| SMILES | C=CCCCCCCCCCCCCCCCC[Si](OC)OC |
| InChI | InChI=1S/C20H41O2Si/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(21-2)22-3/h4H,1,5-20H2,2-3H3 |
| InChIKey | ZZMOTZWZRPIYSJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 169083425 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169083425?
The IUPAC name of CID 169083425 (CID 169083425) is not available.
What is the SMILES notation for CID 169083425?
The canonical SMILES for CID 169083425 is C=CCCCCCCCCCCCCCCCC[Si](OC)OC.
What is the InChIKey of CID 169083425?
The InChIKey is ZZMOTZWZRPIYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41O2Si/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(21-2)22-3/h4H,1,5-20H2,2-3H3.
What are the key properties of CID 169083425?
CID 169083425 has a molecular weight of 341.63 g/mol, XLogP of 6.80, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169083425 is sourced from PubChem (CID 169083425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).