About lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate
lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate (PubChem CID 169084093) has the molecular formula C9H8F2LiNO5S
and a molecular weight of 287.17 g/mol. Its IUPAC name is lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate |
| PubChem CID | 169084093 |
| Molecular Formula | C9H8F2LiNO5S |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)NC2CC(F)(F)C2)o1.[Li+] |
| InChI | InChI=1S/C9H9F2NO5S.Li/c10-9(11)3-5(4-9)12-18(15,16)7-2-1-6(17-7)8(13)14;/h1-2,5,12H,3-4H2,(H,13,14);/q;+1/p-1 |
| InChIKey | QWVUPYYPEYFIFM-UHFFFAOYSA-M |
| XLogP | -3.28 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate?
The IUPAC name of lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate (CID 169084093) is lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate.
What is the SMILES notation for lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate?
The canonical SMILES for lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate is O=C([O-])c1ccc(S(=O)(=O)NC2CC(F)(F)C2)o1.[Li+].
What is the InChIKey of lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate?
The InChIKey is QWVUPYYPEYFIFM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9F2NO5S.Li/c10-9(11)3-5(4-9)12-18(15,16)7-2-1-6(17-7)8(13)14;/h1-2,5,12H,3-4H2,(H,13,14);/q;+1/p-1.
What are the key properties of lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate?
lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate has a molecular weight of 287.17 g/mol, XLogP of -3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 5-[(3,3-difluorocyclobutyl)sulfamoyl]furan-2-carboxylate is sourced from PubChem (CID 169084093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).