C23H19NO5 — CID 169084255
2-benzoyl-3-hydroxy-5,6-dimethoxy-3-phenylisoindol-1-one (PubChem CID 169084255) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-benzoyl-3-hydroxy-5,6-dimethoxy-3-phenylisoindol-1-one.
| Compound Name | 2-benzoyl-3-hydroxy-5,6-dimethoxy-3-phenylisoindol-1-one |
|---|---|
| PubChem CID | 169084255 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-benzoyl-3-hydroxy-5,6-dimethoxy-3-phenylisoindol-1-one |
| SMILES | COc1cc2c(cc1OC)C(O)(c1ccccc1)N(C(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C23H19NO5/c1-28-19-13-17-18(14-20(19)29-2)23(27,16-11-7-4-8-12-16)24(22(17)26)21(25)15-9-5-3-6-10-15/h3-14,27H,1-2H3 |
| InChIKey | KLVYSNZCAJSJOJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|