C16H22O8 — CID 169084927
1,12-bis(hydroxymethyl)-13,15-dioxabicyclo[10.2.2]hexadecane-2,11,14,16-tetrone (PubChem CID 169084927) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is 1,12-bis(hydroxymethyl)-13,15-dioxabicyclo[10.2.2]hexadecane-2,11,14,16-tetrone.
| Compound Name | 1,12-bis(hydroxymethyl)-13,15-dioxabicyclo[10.2.2]hexadecane-2,11,14,16-tetrone |
|---|---|
| PubChem CID | 169084927 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1,12-bis(hydroxymethyl)-13,15-dioxabicyclo[10.2.2]hexadecane-2,11,14,16-tetrone |
| SMILES | O=C1CCCCCCCCC(=O)C2(CO)OC(=O)C1(CO)OC2=O |
| InChI | InChI=1S/C16H22O8/c17-9-15-11(19)7-5-3-1-2-4-6-8-12(20)16(10-18,14(22)23-15)24-13(15)21/h17-18H,1-10H2 |
| InChIKey | NQAOALWBWSUWMO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|