About 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one
3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one (PubChem CID 169085173) has the molecular formula C13H15ClN2O
and a molecular weight of 250.73 g/mol. Its IUPAC name is 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one.
Molecular Properties
| Compound Name | 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one |
| PubChem CID | 169085173 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one |
| SMILES | CN1Cc2ccc(Cl)cc2C2(CC(N)C2)C1=O |
| InChI | InChI=1S/C13H15ClN2O/c1-16-7-8-2-3-9(14)4-11(8)13(12(16)17)5-10(15)6-13/h2-4,10H,5-7,15H2,1H3 |
| InChIKey | FMOGPCRGIVBULS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one?
The IUPAC name of 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one (CID 169085173) is 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one.
What is the SMILES notation for 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one?
The canonical SMILES for 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one is CN1Cc2ccc(Cl)cc2C2(CC(N)C2)C1=O.
What is the InChIKey of 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one?
The InChIKey is FMOGPCRGIVBULS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O/c1-16-7-8-2-3-9(14)4-11(8)13(12(16)17)5-10(15)6-13/h2-4,10H,5-7,15H2,1H3.
What are the key properties of 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one?
3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one has a molecular weight of 250.73 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-amino-6-chloro-2-methylspiro[1H-isoquinoline-4,1'-cyclobutane]-3-one is sourced from PubChem (CID 169085173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).