About 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene
2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene (PubChem CID 169085413) has the molecular formula C22H23O3P
and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene |
| PubChem CID | 169085413 |
| Molecular Formula | C22H23O3P |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(OP(=O)(Oc2cc(C)ccc2C)c2ccccc2)c1 |
| InChI | InChI=1S/C22H23O3P/c1-16-10-12-18(3)21(14-16)24-26(23,20-8-6-5-7-9-20)25-22-15-17(2)11-13-19(22)4/h5-15H,1-4H3 |
| InChIKey | QSCYVBNLVDXFJR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene?
The IUPAC name of 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene (CID 169085413) is 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene.
What is the SMILES notation for 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene?
The canonical SMILES for 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene is Cc1ccc(C)c(OP(=O)(Oc2cc(C)ccc2C)c2ccccc2)c1.
What is the InChIKey of 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene?
The InChIKey is QSCYVBNLVDXFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23O3P/c1-16-10-12-18(3)21(14-16)24-26(23,20-8-6-5-7-9-20)25-22-15-17(2)11-13-19(22)4/h5-15H,1-4H3.
What are the key properties of 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene?
2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene has a molecular weight of 366.40 g/mol, XLogP of 5.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylphenoxy)-phenylphosphoryl]oxy-1,4-dimethylbenzene is sourced from PubChem (CID 169085413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).