C23H21N3O — CID 169085606
3-(benzhydrylideneamino)-6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one (PubChem CID 169085606) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-(benzhydrylideneamino)-6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 3-(benzhydrylideneamino)-6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 169085606 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-(benzhydrylideneamino)-6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one |
| SMILES | CN1C(=O)c2cc(N=C(c3ccccc3)c3ccccc3)cnc2C1(C)C |
| InChI | InChI=1S/C23H21N3O/c1-23(2)21-19(22(27)26(23)3)14-18(15-24-21)25-20(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-15H,1-3H3 |
| InChIKey | TYBXSHYELSHGKX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|