C22H27N3O2 — CID 169086012
tert-butyl N-[2-[4-(7,8-dihydro-6H-isoquinolin-5-ylideneamino)phenyl]ethyl]carbamate (PubChem CID 169086012) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(7,8-dihydro-6H-isoquinolin-5-ylideneamino)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(7,8-dihydro-6H-isoquinolin-5-ylideneamino)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 169086012 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | tert-butyl N-[2-[4-(7,8-dihydro-6H-isoquinolin-5-ylideneamino)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(/N=C2\CCCc3cnccc32)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-22(2,3)27-21(26)24-14-11-16-7-9-18(10-8-16)25-20-6-4-5-17-15-23-13-12-19(17)20/h7-10,12-13,15H,4-6,11,14H2,1-3H3,(H,24,26)/b25-20+ |
| InChIKey | SFHNVWHHGKZLFH-LKUDQCMESA-N |
| XLogP | 4.61 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|