C9H13F3N2O5S — CID 169086123
3-(3-methyl-1H-imidazol-3-ium-2-yl)propane-1-sulfonic acid;2,2,2-trifluoroacetate (PubChem CID 169086123) has the molecular formula C9H13F3N2O5S and a molecular weight of 318.27 g/mol. Its IUPAC name is 3-(3-methyl-1H-imidazol-3-ium-2-yl)propane-1-sulfonic acid;2,2,2-trifluoroacetate.
| Compound Name | 3-(3-methyl-1H-imidazol-3-ium-2-yl)propane-1-sulfonic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 169086123 |
| Molecular Formula | C9H13F3N2O5S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-(3-methyl-1H-imidazol-3-ium-2-yl)propane-1-sulfonic acid;2,2,2-trifluoroacetate |
| SMILES | C[n+]1cc[nH]c1CCCS(=O)(=O)O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H12N2O3S.C2HF3O2/c1-9-5-4-8-7(9)3-2-6-13(10,11)12;3-2(4,5)1(6)7/h4-5H,2-3,6H2,1H3,(H,10,11,12);(H,6,7) |
| InChIKey | LCPNZFMOUQQMEX-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|