C6H12O4S2 — CID 169086256
1,3,2,4-dioxadithiecane 2,2-dioxide (PubChem CID 169086256) has the molecular formula C6H12O4S2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1,3,2,4-dioxadithiecane 2,2-dioxide.
| Compound Name | 1,3,2,4-dioxadithiecane 2,2-dioxide |
|---|---|
| PubChem CID | 169086256 |
| Molecular Formula | C6H12O4S2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 1,3,2,4-dioxadithiecane 2,2-dioxide |
| SMILES | O=S1(=O)OCCCCCCSO1 |
| InChI | InChI=1S/C6H12O4S2/c7-12(8)9-5-3-1-2-4-6-11-10-12/h1-6H2 |
| InChIKey | AINOWMWUJNYXOS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|