C59H55F3N2O4 — CID 169086609
2-N-[2,6-bis[bis(4-methoxyphenyl)methyl]-4-(trifluoromethyl)phenyl]-1-N-(2,6-diethylphenyl)-1,2-dihydroacenaphthylene-1,2-diamine (PubChem CID 169086609) has the molecular formula C59H55F3N2O4 and a molecular weight of 913.09 g/mol. Its IUPAC name is 2-N-[2,6-bis[bis(4-methoxyphenyl)methyl]-4-(trifluoromethyl)phenyl]-1-N-(2,6-diethylphenyl)-1,2-dihydroacenaphthylene-1,2-diamine.
| Compound Name | 2-N-[2,6-bis[bis(4-methoxyphenyl)methyl]-4-(trifluoromethyl)phenyl]-1-N-(2,6-diethylphenyl)-1,2-dihydroacenaphthylene-1,2-diamine |
|---|---|
| PubChem CID | 169086609 |
| Molecular Formula | C59H55F3N2O4 |
| Molecular Weight | 913.09 g/mol |
| Exact Mass | 912.41 |
| IUPAC Name | 2-N-[2,6-bis[bis(4-methoxyphenyl)methyl]-4-(trifluoromethyl)phenyl]-1-N-(2,6-diethylphenyl)-1,2-dihydroacenaphthylene-1,2-diamine |
| SMILES | CCc1cccc(CC)c1NC1c2cccc3cccc(c23)C1Nc1c(C(c2ccc(OC)cc2)c2ccc(OC)cc2)cc(C(F)(F)F)cc1C(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C59H55F3N2O4/c1-7-36-12-9-13-37(8-2)55(36)63-57-48-16-10-14-38-15-11-17-49(54(38)48)58(57)64-56-50(52(39-18-26-44(65-3)27-19-39)40-20-28-45(66-4)29-21-40)34-43(59(60,61)62)35-51(56)53(41-22-30-46(67-5)31-23-41)42-24-32-47(68-6)33-25-42/h9-35,52-53,57-58,63-64H,7-8H2,1-6H3 |
| InChIKey | IPUHPYPTKNZULX-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.09 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|