C25H27N5O2S2 — CID 169086865
2-[[7-(azetidine-1-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]spiro[5H-thieno[2,3-c]pyrrole-4,1'-cyclohexane]-6-one (PubChem CID 169086865) has the molecular formula C25H27N5O2S2 and a molecular weight of 493.66 g/mol. Its IUPAC name is 2-[[7-(azetidine-1-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]spiro[5H-thieno[2,3-c]pyrrole-4,1'-cyclohexane]-6-one.
| Compound Name | 2-[[7-(azetidine-1-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]spiro[5H-thieno[2,3-c]pyrrole-4,1'-cyclohexane]-6-one |
|---|---|
| PubChem CID | 169086865 |
| Molecular Formula | C25H27N5O2S2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[[7-(azetidine-1-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]spiro[5H-thieno[2,3-c]pyrrole-4,1'-cyclohexane]-6-one |
| SMILES | O=C1NC2(CCCCC2)c2cc(Nc3ncnc4sc5c(c34)CCC(C(=O)N3CCC3)C5)sc21 |
| InChI | InChI=1S/C25H27N5O2S2/c31-22-20-16(25(29-22)7-2-1-3-8-25)12-18(34-20)28-21-19-15-6-5-14(24(32)30-9-4-10-30)11-17(15)33-23(19)27-13-26-21/h12-14H,1-11H2,(H,29,31)(H,26,27,28) |
| InChIKey | QABJKXORGPYCMX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |