C18H22Fe — CID 169087262
1,5-bis(but-1-enyl)cyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) (PubChem CID 169087262) has the molecular formula C18H22Fe and a molecular weight of 294.22 g/mol. Its IUPAC name is 1,5-bis(but-1-enyl)cyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 1,5-bis(but-1-enyl)cyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 169087262 |
| Molecular Formula | C18H22Fe |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1,5-bis(but-1-enyl)cyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CCC=Cc1ccc[c-]1C=CCC.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C13H17.C5H5.Fe/c1-3-5-8-12-10-7-11-13(12)9-6-4-2;1-2-4-5-3-1;/h5-11H,3-4H2,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | CUAPGCDPSWJPAU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|