About 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide
5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide (PubChem CID 169087413) has the molecular formula C7H8F3NO3S
and a molecular weight of 243.21 g/mol. Its IUPAC name is 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide.
Molecular Properties
| Compound Name | 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide |
| PubChem CID | 169087413 |
| Molecular Formula | C7H8F3NO3S |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(F)(F)F)o1 |
| InChI | InChI=1S/C7H8F3NO3S/c1-5-2-3-6(14-5)15(12,13)11-4-7(8,9)10/h2-3,11H,4H2,1H3 |
| InChIKey | ZQZUUNHLUUHFGU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide?
The IUPAC name of 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide (CID 169087413) is 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide.
What is the SMILES notation for 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide?
The canonical SMILES for 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide is Cc1ccc(S(=O)(=O)NCC(F)(F)F)o1.
What is the InChIKey of 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide?
The InChIKey is ZQZUUNHLUUHFGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3NO3S/c1-5-2-3-6(14-5)15(12,13)11-4-7(8,9)10/h2-3,11H,4H2,1H3.
What are the key properties of 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide?
5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide has a molecular weight of 243.21 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(2,2,2-trifluoroethyl)furan-2-sulfonamide is sourced from PubChem (CID 169087413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).