About 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole
5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole (PubChem CID 169087982) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole.
Molecular Properties
| Compound Name | 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole |
| PubChem CID | 169087982 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole |
| SMILES | Cc1cc(C)c2c(c1)C(c1cnc[nH]1)=CCO2 |
| InChI | InChI=1S/C14H14N2O/c1-9-5-10(2)14-12(6-9)11(3-4-17-14)13-7-15-8-16-13/h3,5-8H,4H2,1-2H3,(H,15,16) |
| InChIKey | MRPFGFXFABIHOQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole?
The IUPAC name of 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole (CID 169087982) is 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole.
What is the SMILES notation for 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole?
The canonical SMILES for 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole is Cc1cc(C)c2c(c1)C(c1cnc[nH]1)=CCO2.
What is the InChIKey of 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole?
The InChIKey is MRPFGFXFABIHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-9-5-10(2)14-12(6-9)11(3-4-17-14)13-7-15-8-16-13/h3,5-8H,4H2,1-2H3,(H,15,16).
What are the key properties of 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole?
5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole has a molecular weight of 226.28 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6,8-dimethyl-2H-chromen-4-yl)-1H-imidazole is sourced from PubChem (CID 169087982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).