About 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene
3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene (PubChem CID 169088228) has the molecular formula C19H19FOS
and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene |
| PubChem CID | 169088228 |
| Molecular Formula | C19H19FOS |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene |
| SMILES | COc1cc(F)cc(-c2ccc(CC3C=C(C)SC3)cc2)c1 |
| InChI | InChI=1S/C19H19FOS/c1-13-7-15(12-22-13)8-14-3-5-16(6-4-14)17-9-18(20)11-19(10-17)21-2/h3-7,9-11,15H,8,12H2,1-2H3 |
| InChIKey | MFOKCGQBEPAKET-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene?
The IUPAC name of 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene (CID 169088228) is 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene.
What is the SMILES notation for 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene?
The canonical SMILES for 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene is COc1cc(F)cc(-c2ccc(CC3C=C(C)SC3)cc2)c1.
What is the InChIKey of 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene?
The InChIKey is MFOKCGQBEPAKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FOS/c1-13-7-15(12-22-13)8-14-3-5-16(6-4-14)17-9-18(20)11-19(10-17)21-2/h3-7,9-11,15H,8,12H2,1-2H3.
What are the key properties of 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene?
3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene has a molecular weight of 314.43 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(3-fluoro-5-methoxyphenyl)phenyl]methyl]-5-methyl-2,3-dihydrothiophene is sourced from PubChem (CID 169088228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).