C30H39N7O — CID 169088856
4-(cyclohexylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 169088856) has the molecular formula C30H39N7O and a molecular weight of 513.69 g/mol. Its IUPAC name is 4-(cyclohexylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclohexylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 169088856 |
| Molecular Formula | C30H39N7O |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 4-(cyclohexylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1NC1CCCCC1 |
| InChI | InChI=1S/C30H39N7O/c1-21-8-7-9-22(2)27(21)34-29(38)26-20-31-30(35-28(26)32-23-10-5-4-6-11-23)33-24-12-14-25(15-13-24)37-18-16-36(3)17-19-37/h7-9,12-15,20,23H,4-6,10-11,16-19H2,1-3H3,(H,34,38)(H2,31,32,33,35) |
| InChIKey | FVQJYGOXWQDDPJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|