C26H28F3N7O — CID 169088869
4-(cyclobutylamino)-N-(2,6-difluorophenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 169088869) has the molecular formula C26H28F3N7O and a molecular weight of 511.55 g/mol. Its IUPAC name is 4-(cyclobutylamino)-N-(2,6-difluorophenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclobutylamino)-N-(2,6-difluorophenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 169088869 |
| Molecular Formula | C26H28F3N7O |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 4-(cyclobutylamino)-N-(2,6-difluorophenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(C(=O)Nc4c(F)cccc4F)c(NC4CCC4)n3)cc2F)CC1 |
| InChI | InChI=1S/C26H28F3N7O/c1-35-10-12-36(13-11-35)22-9-8-17(14-21(22)29)32-26-30-15-18(24(34-26)31-16-4-2-5-16)25(37)33-23-19(27)6-3-7-20(23)28/h3,6-9,14-16H,2,4-5,10-13H2,1H3,(H,33,37)(H2,30,31,32,34) |
| InChIKey | NKDDOPUFCHJQIU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|