C31H48O4 — CID 169089619
methyl (5R)-5-[(3S,5R,10S,13R,14R,17R)-3-acetyloxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate (PubChem CID 169089619) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is methyl (5R)-5-[(3S,5R,10S,13R,14R,17R)-3-acetyloxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate.
| Compound Name | methyl (5R)-5-[(3S,5R,10S,13R,14R,17R)-3-acetyloxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate |
|---|---|
| PubChem CID | 169089619 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | methyl (5R)-5-[(3S,5R,10S,13R,14R,17R)-3-acetyloxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate |
| SMILES | COC(=O)CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=CC[C@H]4C(C)(C)[C@@H](OC(C)=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C31H48O4/c1-20(10-9-11-27(33)34-8)22-14-18-31(7)24-12-13-25-28(3,4)26(35-21(2)32)16-17-29(25,5)23(24)15-19-30(22,31)6/h12,15,20,22,25-26H,9-11,13-14,16-19H2,1-8H3/t20-,22-,25+,26+,29-,30-,31+/m1/s1 |
| InChIKey | NJAKSWPSLJHSHY-SXEWFJSESA-N |
| XLogP | 7.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |