C36H26N4O5S — CID 169090035
N-[8-(2-nitrophenyl)-1,3,4-triphenyl-7-oxa-1,2-diazaspiro[4.4]nona-2,8-dien-6-ylidene]benzenesulfonamide (PubChem CID 169090035) has the molecular formula C36H26N4O5S and a molecular weight of 626.69 g/mol. Its IUPAC name is N-[8-(2-nitrophenyl)-1,3,4-triphenyl-7-oxa-1,2-diazaspiro[4.4]nona-2,8-dien-6-ylidene]benzenesulfonamide.
| Compound Name | N-[8-(2-nitrophenyl)-1,3,4-triphenyl-7-oxa-1,2-diazaspiro[4.4]nona-2,8-dien-6-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 169090035 |
| Molecular Formula | C36H26N4O5S |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | N-[8-(2-nitrophenyl)-1,3,4-triphenyl-7-oxa-1,2-diazaspiro[4.4]nona-2,8-dien-6-ylidene]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1C1=CC2(C(=NS(=O)(=O)c3ccccc3)O1)C(c1ccccc1)C(c1ccccc1)=NN2c1ccccc1 |
| InChI | InChI=1S/C36H26N4O5S/c41-40(42)31-24-14-13-23-30(31)32-25-36(35(45-32)38-46(43,44)29-21-11-4-12-22-29)33(26-15-5-1-6-16-26)34(27-17-7-2-8-18-27)37-39(36)28-19-9-3-10-20-28/h1-25,33H |
| InChIKey | LTRHQMHDJSHDSA-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|