C41H47N3O6 — CID 169090181
naphthalen-1-ylmethyl 4-[2-cyano-5-[[(1R,2R,3S,4S)-3-(2,2-dimethylpropylcarbamoyl)-2-bicyclo[2.2.1]hept-5-enyl]carbamoyl]-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylate (PubChem CID 169090181) has the molecular formula C41H47N3O6 and a molecular weight of 677.84 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 4-[2-cyano-5-[[(1R,2R,3S,4S)-3-(2,2-dimethylpropylcarbamoyl)-2-bicyclo[2.2.1]hept-5-enyl]carbamoyl]-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylate.
| Compound Name | naphthalen-1-ylmethyl 4-[2-cyano-5-[[(1R,2R,3S,4S)-3-(2,2-dimethylpropylcarbamoyl)-2-bicyclo[2.2.1]hept-5-enyl]carbamoyl]-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 169090181 |
| Molecular Formula | C41H47N3O6 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.35 |
| IUPAC Name | naphthalen-1-ylmethyl 4-[2-cyano-5-[[(1R,2R,3S,4S)-3-(2,2-dimethylpropylcarbamoyl)-2-bicyclo[2.2.1]hept-5-enyl]carbamoyl]-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylate |
| SMILES | COc1cc(C#N)c(OC2CCC(C)(C(=O)OCc3cccc4ccccc34)CC2)cc1C(=O)N[C@H]1[C@@H](C(=O)NCC(C)(C)C)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C41H47N3O6/c1-40(2,3)24-43-38(46)35-26-13-14-27(19-26)36(35)44-37(45)32-21-33(29(22-42)20-34(32)48-5)50-30-15-17-41(4,18-16-30)39(47)49-23-28-11-8-10-25-9-6-7-12-31(25)28/h6-14,20-21,26-27,30,35-36H,15-19,23-24H2,1-5H3,(H,43,46)(H,44,45)/t26-,27+,30?,35+,36-,41?/m1/s1 |
| InChIKey | ZVDVKNQHQDCVKC-XEHVLUEESA-N |
| XLogP | 6.87 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|