About 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide
3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 16909098) has the molecular formula C14H17N3OS2
and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide |
| PubChem CID | 16909098 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | Cc1nc(CSCCC(=O)NCc2ccncc2)cs1 |
| InChI | InChI=1S/C14H17N3OS2/c1-11-17-13(10-20-11)9-19-7-4-14(18)16-8-12-2-5-15-6-3-12/h2-3,5-6,10H,4,7-9H2,1H3,(H,16,18) |
| InChIKey | FKLGRAGPYHLLGV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide?
The IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide (CID 16909098) is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide.
What is the SMILES notation for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide?
The canonical SMILES for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide is Cc1nc(CSCCC(=O)NCc2ccncc2)cs1.
What is the InChIKey of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide?
The InChIKey is FKLGRAGPYHLLGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3OS2/c1-11-17-13(10-20-11)9-19-7-4-14(18)16-8-12-2-5-15-6-3-12/h2-3,5-6,10H,4,7-9H2,1H3,(H,16,18).
What are the key properties of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide?
3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide has a molecular weight of 307.44 g/mol, XLogP of 2.79, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(pyridin-4-ylmethyl)propanamide is sourced from PubChem (CID 16909098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).