About 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline
3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline (PubChem CID 169091916) has the molecular formula C19H21F2N3O3
and a molecular weight of 377.39 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline.
Molecular Properties
| Compound Name | 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline |
| PubChem CID | 169091916 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline |
| SMILES | COc1ccc(CNc2ccc([N+](=O)[O-])c(N3CCC(F)(F)CC3)c2)cc1 |
| InChI | InChI=1S/C19H21F2N3O3/c1-27-16-5-2-14(3-6-16)13-22-15-4-7-17(24(25)26)18(12-15)23-10-8-19(20,21)9-11-23/h2-7,12,22H,8-11,13H2,1H3 |
| InChIKey | ULHAVMMYLFEBGF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline?
The IUPAC name of 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline (CID 169091916) is 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline.
What is the SMILES notation for 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline?
The canonical SMILES for 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline is COc1ccc(CNc2ccc([N+](=O)[O-])c(N3CCC(F)(F)CC3)c2)cc1.
What is the InChIKey of 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline?
The InChIKey is ULHAVMMYLFEBGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2N3O3/c1-27-16-5-2-14(3-6-16)13-22-15-4-7-17(24(25)26)18(12-15)23-10-8-19(20,21)9-11-23/h2-7,12,22H,8-11,13H2,1H3.
What are the key properties of 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline?
3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline has a molecular weight of 377.39 g/mol, XLogP of 4.45, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-difluoropiperidin-1-yl)-N-[(4-methoxyphenyl)methyl]-4-nitroaniline is sourced from PubChem (CID 169091916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).