About 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine
5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine (PubChem CID 169091957) has the molecular formula C10H12BrF2N3
and a molecular weight of 292.13 g/mol. Its IUPAC name is 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine |
| PubChem CID | 169091957 |
| Molecular Formula | C10H12BrF2N3 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine |
| SMILES | Nc1ccc(Br)c(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C10H12BrF2N3/c11-7-1-2-8(14)15-9(7)16-5-3-10(12,13)4-6-16/h1-2H,3-6H2,(H2,14,15) |
| InChIKey | NDOBNSAUXZXVSK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine?
The IUPAC name of 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine (CID 169091957) is 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine.
What is the SMILES notation for 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine?
The canonical SMILES for 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine is Nc1ccc(Br)c(N2CCC(F)(F)CC2)n1.
What is the InChIKey of 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine?
The InChIKey is NDOBNSAUXZXVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrF2N3/c11-7-1-2-8(14)15-9(7)16-5-3-10(12,13)4-6-16/h1-2H,3-6H2,(H2,14,15).
What are the key properties of 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine?
5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine has a molecular weight of 292.13 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-(4,4-difluoropiperidin-1-yl)pyridin-2-amine is sourced from PubChem (CID 169091957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).