About 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide
4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide (PubChem CID 169092120) has the molecular formula C15H16N2O4
and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide.
Molecular Properties
| Compound Name | 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide |
| PubChem CID | 169092120 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide |
| SMILES | O=C(CCCN1C(=O)C/C(=C\c2ccccc2)C1=O)NO |
| InChI | InChI=1S/C15H16N2O4/c18-13(16-21)7-4-8-17-14(19)10-12(15(17)20)9-11-5-2-1-3-6-11/h1-3,5-6,9,21H,4,7-8,10H2,(H,16,18)/b12-9+ |
| InChIKey | ATFSHRCFTWALEY-FMIVXFBMSA-N |
| XLogP | 1.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide?
The IUPAC name of 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide (CID 169092120) is 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide.
What is the SMILES notation for 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide?
The canonical SMILES for 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide is O=C(CCCN1C(=O)C/C(=C\c2ccccc2)C1=O)NO.
What is the InChIKey of 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide?
The InChIKey is ATFSHRCFTWALEY-FMIVXFBMSA-N. The full InChI is InChI=1S/C15H16N2O4/c18-13(16-21)7-4-8-17-14(19)10-12(15(17)20)9-11-5-2-1-3-6-11/h1-3,5-6,9,21H,4,7-8,10H2,(H,16,18)/b12-9+.
What are the key properties of 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide?
4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide has a molecular weight of 288.30 g/mol, XLogP of 1.11, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-3-benzylidene-2,5-dioxopyrrolidin-1-yl]-N-hydroxybutanamide is sourced from PubChem (CID 169092120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).