C22H33NO7S — CID 169092366
3-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-1-(2-methylphenyl)cyclobutane-1-sulfonic acid (PubChem CID 169092366) has the molecular formula C22H33NO7S and a molecular weight of 455.57 g/mol. Its IUPAC name is 3-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-1-(2-methylphenyl)cyclobutane-1-sulfonic acid.
| Compound Name | 3-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-1-(2-methylphenyl)cyclobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 169092366 |
| Molecular Formula | C22H33NO7S |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-1-(2-methylphenyl)cyclobutane-1-sulfonic acid |
| SMILES | Cc1ccccc1C1(S(=O)(=O)O)CC(CN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H33NO7S/c1-15-10-8-9-11-17(15)22(31(26,27)28)12-16(13-22)14-23(18(24)29-20(2,3)4)19(25)30-21(5,6)7/h8-11,16H,12-14H2,1-7H3,(H,26,27,28) |
| InChIKey | HBFFQMHPYAAGHB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|