About 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one
6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one (PubChem CID 169092772) has the molecular formula C11H11F2NO2
and a molecular weight of 227.21 g/mol. Its IUPAC name is 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one |
| PubChem CID | 169092772 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one |
| SMILES | CCc1ccc2c(c1)C(F)(F)C(O)NC2=O |
| InChI | InChI=1S/C11H11F2NO2/c1-2-6-3-4-7-8(5-6)11(12,13)10(16)14-9(7)15/h3-5,10,16H,2H2,1H3,(H,14,15) |
| InChIKey | CVKAUAZHFCCGKN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one?
The IUPAC name of 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one (CID 169092772) is 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one.
What is the SMILES notation for 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one?
The canonical SMILES for 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one is CCc1ccc2c(c1)C(F)(F)C(O)NC2=O.
What is the InChIKey of 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one?
The InChIKey is CVKAUAZHFCCGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO2/c1-2-6-3-4-7-8(5-6)11(12,13)10(16)14-9(7)15/h3-5,10,16H,2H2,1H3,(H,14,15).
What are the key properties of 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one?
6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one has a molecular weight of 227.21 g/mol, XLogP of 1.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one is sourced from PubChem (CID 169092772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).