C25H25N5O — CID 169092823
N-tert-butyl-10-(4-methoxyphenyl)-8,10,12,18-tetrazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2,4,6,13,15,17-heptaen-9-imine (PubChem CID 169092823) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is N-tert-butyl-10-(4-methoxyphenyl)-8,10,12,18-tetrazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2,4,6,13,15,17-heptaen-9-imine.
| Compound Name | N-tert-butyl-10-(4-methoxyphenyl)-8,10,12,18-tetrazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2,4,6,13,15,17-heptaen-9-imine |
|---|---|
| PubChem CID | 169092823 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-tert-butyl-10-(4-methoxyphenyl)-8,10,12,18-tetrazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2,4,6,13,15,17-heptaen-9-imine |
| SMILES | COc1ccc(N2/C(=N/C(C)(C)C)Nc3ccccc3-c3nc4ccccn4c32)cc1 |
| InChI | InChI=1S/C25H25N5O/c1-25(2,3)28-24-26-20-10-6-5-9-19(20)22-23(29-16-8-7-11-21(29)27-22)30(24)17-12-14-18(31-4)15-13-17/h5-16H,1-4H3,(H,26,28) |
| InChIKey | PMZXWDNNILFUGB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 54.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|