About dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate
dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate (PubChem CID 169093048) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate.
Molecular Properties
| Compound Name | dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate |
| PubChem CID | 169093048 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate |
| SMILES | C=CC(=O)NCCC[NH+](C)C.CCC(=O)[O-] |
| InChI | InChI=1S/C8H16N2O.C3H6O2/c1-4-8(11)9-6-5-7-10(2)3;1-2-3(4)5/h4H,1,5-7H2,2-3H3,(H,9,11);2H2,1H3,(H,4,5) |
| InChIKey | ANXQXGKRECTFAC-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate?
The IUPAC name of dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate (CID 169093048) is dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate.
What is the SMILES notation for dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate?
The canonical SMILES for dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate is C=CC(=O)NCCC[NH+](C)C.CCC(=O)[O-].
What is the InChIKey of dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate?
The InChIKey is ANXQXGKRECTFAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C3H6O2/c1-4-8(11)9-6-5-7-10(2)3;1-2-3(4)5/h4H,1,5-7H2,2-3H3,(H,9,11);2H2,1H3,(H,4,5).
What are the key properties of dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate?
dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate has a molecular weight of 230.31 g/mol, XLogP of -2.03, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propanoate is sourced from PubChem (CID 169093048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).