C16H11F — CID 169094076
3-fluorotricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-8-yne (PubChem CID 169094076) has the molecular formula C16H11F and a molecular weight of 222.26 g/mol. Its IUPAC name is 3-fluorotricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-8-yne.
| Compound Name | 3-fluorotricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-8-yne |
|---|---|
| PubChem CID | 169094076 |
| Molecular Formula | C16H11F |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-fluorotricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-8-yne |
| SMILES | Fc1cccc2c1-c1ccccc1CCC#C2 |
| InChI | InChI=1S/C16H11F/c17-15-11-5-9-13-8-2-1-6-12-7-3-4-10-14(12)16(13)15/h3-5,7,9-11H,1,6H2 |
| InChIKey | UUFHWWSTYHLPLD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|