About 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide
1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide (PubChem CID 169094165) has the molecular formula C5H11Cl2InN2
and a molecular weight of 284.88 g/mol. Its IUPAC name is 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide.
Molecular Properties
| Compound Name | 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide |
| PubChem CID | 169094165 |
| Molecular Formula | C5H11Cl2InN2 |
| Molecular Weight | 284.88 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide |
| SMILES | CCN(C)/C(=N/C)[In](Cl)Cl |
| InChI | InChI=1S/C5H11N2.2ClH.In/c1-4-7(3)5-6-2;;;/h4H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SNOJSWOXDNCQJB-UHFFFAOYSA-L |
| XLogP | 1.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.88 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide?
The IUPAC name of 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide (CID 169094165) is 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide.
What is the SMILES notation for 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide?
The canonical SMILES for 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide is CCN(C)/C(=N/C)[In](Cl)Cl.
What is the InChIKey of 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide?
The InChIKey is SNOJSWOXDNCQJB-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H11N2.2ClH.In/c1-4-7(3)5-6-2;;;/h4H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide?
1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide has a molecular weight of 284.88 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dichloroindiganyl-N-ethyl-N,N'-dimethylmethanimidamide is sourced from PubChem (CID 169094165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).