C15H10ClN3O2S — CID 169094409
4-[5-[(3-chlorophenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzene-1,2-diol (PubChem CID 169094409) has the molecular formula C15H10ClN3O2S and a molecular weight of 331.78 g/mol. Its IUPAC name is 4-[5-[(3-chlorophenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzene-1,2-diol.
| Compound Name | 4-[5-[(3-chlorophenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 169094409 |
| Molecular Formula | C15H10ClN3O2S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 4-[5-[(3-chlorophenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2nnc(N=Cc3cccc(Cl)c3)s2)cc1O |
| InChI | InChI=1S/C15H10ClN3O2S/c16-11-3-1-2-9(6-11)8-17-15-19-18-14(22-15)10-4-5-12(20)13(21)7-10/h1-8,20-21H |
| InChIKey | PXGQDZWCDWLIPA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|