C30H21ClN2OSe2 — CID 169094448
N-[2-[4-chloro-2,6-bis(phenylselanyl)phenyl]phenyl]pyridine-2-carboxamide (PubChem CID 169094448) has the molecular formula C30H21ClN2OSe2 and a molecular weight of 618.88 g/mol. Its IUPAC name is N-[2-[4-chloro-2,6-bis(phenylselanyl)phenyl]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[2-[4-chloro-2,6-bis(phenylselanyl)phenyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169094448 |
| Molecular Formula | C30H21ClN2OSe2 |
| Molecular Weight | 618.88 g/mol |
| Exact Mass | 619.97 |
| IUPAC Name | N-[2-[4-chloro-2,6-bis(phenylselanyl)phenyl]phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1c([Se]c2ccccc2)cc(Cl)cc1[Se]c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C30H21ClN2OSe2/c31-21-19-27(35-22-11-3-1-4-12-22)29(28(20-21)36-23-13-5-2-6-14-23)24-15-7-8-16-25(24)33-30(34)26-17-9-10-18-32-26/h1-20H,(H,33,34) |
| InChIKey | XYDOXKPHUXNLTK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|