C21H23FN4O4S — CID 169094532
1-ethyl-3-[[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate (PubChem CID 169094532) has the molecular formula C21H23FN4O4S and a molecular weight of 446.50 g/mol. Its IUPAC name is 1-ethyl-3-[[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate.
| Compound Name | 1-ethyl-3-[[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate |
|---|---|
| PubChem CID | 169094532 |
| Molecular Formula | C21H23FN4O4S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-ethyl-3-[[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate |
| SMILES | CC[n+]1c([O-])c(CN2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)c(=O)n2ccccc21 |
| InChI | InChI=1S/C21H23FN4O4S/c1-2-25-19-5-3-4-10-26(19)21(28)18(20(25)27)15-23-11-13-24(14-12-23)31(29,30)17-8-6-16(22)7-9-17/h3-10H,2,11-15H2,1H3 |
| InChIKey | XBDITHWXXHPUSS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|