C11H12N2O2 — CID 169094579
4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-2-olate (PubChem CID 169094579) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-2-olate.
| Compound Name | 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-2-olate |
|---|---|
| PubChem CID | 169094579 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-oxo-1-propylpyrido[1,2-a]pyrimidin-1-ium-2-olate |
| SMILES | CCC[n+]1c([O-])cc(=O)n2ccccc21 |
| InChI | InChI=1S/C11H12N2O2/c1-2-6-12-9-5-3-4-7-13(9)11(15)8-10(12)14/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | JRJCXLIRMKKEDA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|