About 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one
7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one (PubChem CID 169095322) has the molecular formula C13H7F3N2OS
and a molecular weight of 296.27 g/mol. Its IUPAC name is 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one.
Molecular Properties
| Compound Name | 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one |
| PubChem CID | 169095322 |
| Molecular Formula | C13H7F3N2OS |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one |
| SMILES | CSc1ccc2c(c1)C(=O)c1nc(C(F)(F)F)ncc1-2 |
| InChI | InChI=1S/C13H7F3N2OS/c1-20-6-2-3-7-8(4-6)11(19)10-9(7)5-17-12(18-10)13(14,15)16/h2-5H,1H3 |
| InChIKey | XYBADUIVKPGLDZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one?
The IUPAC name of 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one (CID 169095322) is 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one.
What is the SMILES notation for 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one?
The canonical SMILES for 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one is CSc1ccc2c(c1)C(=O)c1nc(C(F)(F)F)ncc1-2.
What is the InChIKey of 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one?
The InChIKey is XYBADUIVKPGLDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3N2OS/c1-20-6-2-3-7-8(4-6)11(19)10-9(7)5-17-12(18-10)13(14,15)16/h2-5H,1H3.
What are the key properties of 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one?
7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one has a molecular weight of 296.27 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylsulfanyl-2-(trifluoromethyl)indeno[2,1-d]pyrimidin-9-one is sourced from PubChem (CID 169095322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).