About 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one
5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one (PubChem CID 169095498) has the molecular formula C13H15F2NO2
and a molecular weight of 255.26 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one |
| PubChem CID | 169095498 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one |
| SMILES | CCc1ccc(C2(OC)CC(F)(F)C(=O)N2)cc1 |
| InChI | InChI=1S/C13H15F2NO2/c1-3-9-4-6-10(7-5-9)13(18-2)8-12(14,15)11(17)16-13/h4-7H,3,8H2,1-2H3,(H,16,17) |
| InChIKey | BTVCLYBTXBBHDF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one?
The IUPAC name of 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one (CID 169095498) is 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one.
What is the SMILES notation for 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one?
The canonical SMILES for 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one is CCc1ccc(C2(OC)CC(F)(F)C(=O)N2)cc1.
What is the InChIKey of 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one?
The InChIKey is BTVCLYBTXBBHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO2/c1-3-9-4-6-10(7-5-9)13(18-2)8-12(14,15)11(17)16-13/h4-7H,3,8H2,1-2H3,(H,16,17).
What are the key properties of 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one?
5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one has a molecular weight of 255.26 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethylphenyl)-3,3-difluoro-5-methoxypyrrolidin-2-one is sourced from PubChem (CID 169095498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).