C26H21N3O10 — CID 169095954
trimethyl (3R,10bR)-3-(4-nitro-1,3-dioxoisoindol-2-yl)-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,1,6-tricarboxylate (PubChem CID 169095954) has the molecular formula C26H21N3O10 and a molecular weight of 535.47 g/mol. Its IUPAC name is trimethyl (3R,10bR)-3-(4-nitro-1,3-dioxoisoindol-2-yl)-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,1,6-tricarboxylate.
| Compound Name | trimethyl (3R,10bR)-3-(4-nitro-1,3-dioxoisoindol-2-yl)-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,1,6-tricarboxylate |
|---|---|
| PubChem CID | 169095954 |
| Molecular Formula | C26H21N3O10 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | trimethyl (3R,10bR)-3-(4-nitro-1,3-dioxoisoindol-2-yl)-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,1,6-tricarboxylate |
| SMILES | COC(=O)C1=CN2[C@H](N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)CC(C(=O)OC)(C(=O)OC)[C@H]2c2ccccc21 |
| InChI | InChI=1S/C26H21N3O10/c1-37-23(32)16-12-27-18(28-21(30)15-9-6-10-17(29(35)36)19(15)22(28)31)11-26(24(33)38-2,25(34)39-3)20(27)14-8-5-4-7-13(14)16/h4-10,12,18,20H,11H2,1-3H3/t18-,20-/m1/s1 |
| InChIKey | LNOCGLMLWZENLH-UYAOXDASSA-N |
| XLogP | 1.82 |
| TPSA | 162.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|