C19H24F2N8O2 — CID 169096056
methyl 2-[(3R)-1-[6-[5-(azidomethyl)-1-methyltriazol-4-yl]-2-ethyl-3-pyridinyl]-5,5-difluoropiperidin-3-yl]acetate (PubChem CID 169096056) has the molecular formula C19H24F2N8O2 and a molecular weight of 434.45 g/mol. Its IUPAC name is methyl 2-[(3R)-1-[6-[5-(azidomethyl)-1-methyltriazol-4-yl]-2-ethyl-3-pyridinyl]-5,5-difluoropiperidin-3-yl]acetate.
| Compound Name | methyl 2-[(3R)-1-[6-[5-(azidomethyl)-1-methyltriazol-4-yl]-2-ethyl-3-pyridinyl]-5,5-difluoropiperidin-3-yl]acetate |
|---|---|
| PubChem CID | 169096056 |
| Molecular Formula | C19H24F2N8O2 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | methyl 2-[(3R)-1-[6-[5-(azidomethyl)-1-methyltriazol-4-yl]-2-ethyl-3-pyridinyl]-5,5-difluoropiperidin-3-yl]acetate |
| SMILES | CCc1nc(-c2nnn(C)c2CN=[N+]=[N-])ccc1N1C[C@H](CC(=O)OC)CC(F)(F)C1 |
| InChI | InChI=1S/C19H24F2N8O2/c1-4-13-15(29-10-12(7-17(30)31-3)8-19(20,21)11-29)6-5-14(24-13)18-16(9-23-26-22)28(2)27-25-18/h5-6,12H,4,7-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | SXQAEOHLQDQQNT-GFCCVEGCSA-N |
| XLogP | 3.27 |
| TPSA | 121.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|