C21H26F3NO5 — CID 169096530
[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-[2-(cyclopenten-1-yl)phenyl]-2-hydroxyacetate;2,2,2-trifluoroacetate (PubChem CID 169096530) has the molecular formula C21H26F3NO5 and a molecular weight of 429.44 g/mol. Its IUPAC name is [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-[2-(cyclopenten-1-yl)phenyl]-2-hydroxyacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-[2-(cyclopenten-1-yl)phenyl]-2-hydroxyacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 169096530 |
| Molecular Formula | C21H26F3NO5 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-[2-(cyclopenten-1-yl)phenyl]-2-hydroxyacetate;2,2,2-trifluoroacetate |
| SMILES | C[N+]1(C)CC[C@@H](OC(=O)C(O)c2ccccc2C2=CCCC2)C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H26NO3.C2HF3O2/c1-20(2)12-11-15(13-20)23-19(22)18(21)17-10-6-5-9-16(17)14-7-3-4-8-14;3-2(4,5)1(6)7/h5-7,9-10,15,18,21H,3-4,8,11-13H2,1-2H3;(H,6,7)/q+1;/p-1/t15-,18?;/m1./s1 |
| InChIKey | VIMXIOHLYGZDOY-BARLLYERSA-M |
| XLogP | 1.98 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|