C21H24N2O5 — CID 169096890
methyl (2S,3S,4S,5S)-3-(4-ethoxyphenyl)-2-methyl-4-nitro-5-phenylpyrrolidine-2-carboxylate (PubChem CID 169096890) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl (2S,3S,4S,5S)-3-(4-ethoxyphenyl)-2-methyl-4-nitro-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5S)-3-(4-ethoxyphenyl)-2-methyl-4-nitro-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 169096890 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl (2S,3S,4S,5S)-3-(4-ethoxyphenyl)-2-methyl-4-nitro-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CCOc1ccc([C@H]2[C@H]([N+](=O)[O-])[C@H](c3ccccc3)N[C@]2(C)C(=O)OC)cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-4-28-16-12-10-14(11-13-16)17-19(23(25)26)18(15-8-6-5-7-9-15)22-21(17,2)20(24)27-3/h5-13,17-19,22H,4H2,1-3H3/t17-,18-,19-,21-/m0/s1 |
| InChIKey | JKZIRMBAFGINIL-IWFBPKFRSA-N |
| XLogP | 3.09 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|