C22H26N2O5 — CID 169096901
methyl (2S,3R,4S,5S)-3-(4-ethoxyphenyl)-2,4-dimethyl-4-nitro-5-phenylpyrrolidine-2-carboxylate (PubChem CID 169096901) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S)-3-(4-ethoxyphenyl)-2,4-dimethyl-4-nitro-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S)-3-(4-ethoxyphenyl)-2,4-dimethyl-4-nitro-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 169096901 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | methyl (2S,3R,4S,5S)-3-(4-ethoxyphenyl)-2,4-dimethyl-4-nitro-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CCOc1ccc([C@H]2[C@](C)([N+](=O)[O-])[C@H](c3ccccc3)N[C@]2(C)C(=O)OC)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-5-29-17-13-11-15(12-14-17)18-21(2,20(25)28-4)23-19(22(18,3)24(26)27)16-9-7-6-8-10-16/h6-14,18-19,23H,5H2,1-4H3/t18-,19+,21+,22+/m1/s1 |
| InChIKey | LVSHUYCCOPBIHN-WAGURGNTSA-N |
| XLogP | 3.48 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|