About 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one
5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 169096926) has the molecular formula C31H30BrN2OP
and a molecular weight of 557.47 g/mol. Its IUPAC name is 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one |
| PubChem CID | 169096926 |
| Molecular Formula | C31H30BrN2OP |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | O=c1cc(CCCCP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C31H30BrN2OP/c32-36(28-18-7-2-8-19-28,29-20-9-3-10-21-29,30-22-11-4-12-23-30)24-14-13-15-26-25-31(35)34(33-26)27-16-5-1-6-17-27/h1-12,16-23,25,33H,13-15,24H2 |
| InChIKey | OZLVHAGCMGUIJE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one?
The IUPAC name of 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one (CID 169096926) is 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one.
What is the SMILES notation for 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one?
The canonical SMILES for 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one is O=c1cc(CCCCP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)[nH]n1-c1ccccc1.
What is the InChIKey of 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one?
The InChIKey is OZLVHAGCMGUIJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H30BrN2OP/c32-36(28-18-7-2-8-19-28,29-20-9-3-10-21-29,30-22-11-4-12-23-30)24-14-13-15-26-25-31(35)34(33-26)27-16-5-1-6-17-27/h1-12,16-23,25,33H,13-15,24H2.
What are the key properties of 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one?
5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one has a molecular weight of 557.47 g/mol, XLogP of 6.33, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[bromo(triphenyl)-λ5-phosphanyl]butyl]-2-phenyl-1H-pyrazol-3-one is sourced from PubChem (CID 169096926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).