C11H22ClNO2 — CID 169097448
4-(2-chloroethoxy)-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium (PubChem CID 169097448) has the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. Its IUPAC name is 4-(2-chloroethoxy)-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium.
| Compound Name | 4-(2-chloroethoxy)-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium |
|---|---|
| PubChem CID | 169097448 |
| Molecular Formula | C11H22ClNO2 |
| Molecular Weight | 235.75 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 4-(2-chloroethoxy)-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium |
| SMILES | CC1(C)CC(OCCCl)CC(C)(C)[NH+]1[O-] |
| InChI | InChI=1S/C11H22ClNO2/c1-10(2)7-9(15-6-5-12)8-11(3,4)13(10)14/h9,13H,5-8H2,1-4H3 |
| InChIKey | WABTVRJINZARNN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 36.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.75 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|