About 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea
1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea (PubChem CID 169097700) has the molecular formula C11H11F3N4O
and a molecular weight of 272.23 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea.
Molecular Properties
| Compound Name | 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea |
| PubChem CID | 169097700 |
| Molecular Formula | C11H11F3N4O |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea |
| SMILES | CN(C)C(=O)Nc1cc2[nH]c(C(F)(F)F)cc2cn1 |
| InChI | InChI=1S/C11H11F3N4O/c1-18(2)10(19)17-9-4-7-6(5-15-9)3-8(16-7)11(12,13)14/h3-5,16H,1-2H3,(H,15,17,19) |
| InChIKey | PMOWDTDIHDCLAZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea?
The IUPAC name of 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea (CID 169097700) is 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea.
What is the SMILES notation for 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea?
The canonical SMILES for 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea is CN(C)C(=O)Nc1cc2[nH]c(C(F)(F)F)cc2cn1.
What is the InChIKey of 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea?
The InChIKey is PMOWDTDIHDCLAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3N4O/c1-18(2)10(19)17-9-4-7-6(5-15-9)3-8(16-7)11(12,13)14/h3-5,16H,1-2H3,(H,15,17,19).
What are the key properties of 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea?
1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea has a molecular weight of 272.23 g/mol, XLogP of 2.68, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3-[2-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridin-6-yl]urea is sourced from PubChem (CID 169097700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).