C20H24ClF3N4OSi — CID 169097916
4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-2-yl]-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 169097916) has the molecular formula C20H24ClF3N4OSi and a molecular weight of 456.97 g/mol. Its IUPAC name is 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-2-yl]-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-2-yl]-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 169097916 |
| Molecular Formula | C20H24ClF3N4OSi |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-2-yl]-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccnc(NCC(F)(F)F)c2)cc2cnc(Cl)cc21 |
| InChI | InChI=1S/C20H24ClF3N4OSi/c1-30(2,3)7-6-29-13-28-16(8-15-11-26-18(21)10-17(15)28)14-4-5-25-19(9-14)27-12-20(22,23)24/h4-5,8-11H,6-7,12-13H2,1-3H3,(H,25,27) |
| InChIKey | ZEXNWIKYNWFKFJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|