3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate

C12H18O3 — CID 169099146

IUPAC3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate
SMILESCC(C)CCOC(=O)C1CCC=CC1=O
InChIInChI=1S/C12H18O3/c1-9(2)7-8-15-12(14)10-5-3-4-6-11(10)13/h4,6,9-10H,3,5,7-8H2,1-2H3
InChIKeyNVOXRWNONCODMI-UHFFFAOYSA-N
MW210.27 g/mol
LogP2.11
Rot. Bonds4

About 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate

3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 169099146) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate.

Molecular Properties

Compound Name3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate
PubChem CID169099146
Molecular FormulaC12H18O3
Molecular Weight210.27 g/mol
Exact Mass210.13
IUPAC Name3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate
SMILESCC(C)CCOC(=O)C1CCC=CC1=O
InChIInChI=1S/C12H18O3/c1-9(2)7-8-15-12(14)10-5-3-4-6-11(10)13/h4,6,9-10H,3,5,7-8H2,1-2H3
InChIKeyNVOXRWNONCODMI-UHFFFAOYSA-N
XLogP2.11
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.27
LogP ≤ 52.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate?
The IUPAC name of 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate (CID 169099146) is 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate.
What is the SMILES notation for 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate?
The canonical SMILES for 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate is CC(C)CCOC(=O)C1CCC=CC1=O.
What is the InChIKey of 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate?
The InChIKey is NVOXRWNONCODMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-9(2)7-8-15-12(14)10-5-3-4-6-11(10)13/h4,6,9-10H,3,5,7-8H2,1-2H3.
What are the key properties of 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate?
3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate has a molecular weight of 210.27 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 2-oxocyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 169099146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).